What is the molecular formula of 1,2,3,4-Tetrafluorobenzene?
The molecular formula of 1,2,3,4-Tetrafluorobenzene is C6H2F4.
What is the molecular weight of 1,2,3,4-Tetrafluorobenzene?
The molecular weight of 1,2,3,4-Tetrafluorobenzene is 150.07 g/mol.
What is the IUPAC name of 1,2,3,4-Tetrafluorobenzene?
The IUPAC name of 1,2,3,4-Tetrafluorobenzene is 1,2,3,4-tetrafluorobenzene.
What is the InChI of 1,2,3,4-Tetrafluorobenzene?
The InChI of 1,2,3,4-Tetrafluorobenzene is InChI=1S/C6H2F4/c7-3-1-2-4(8)6(10)5(3)9/h1-2H.
What is the InChIKey of 1,2,3,4-Tetrafluorobenzene?
The InChIKey of 1,2,3,4-Tetrafluorobenzene is SOZFIIXUNAKEJP-UHFFFAOYSA-N.
What is the canonical SMILES of 1,2,3,4-Tetrafluorobenzene?
The canonical SMILES of 1,2,3,4-Tetrafluorobenzene is C1=CC(=C(C(=C1F)F)F)F.
What is the CAS number of 1,2,3,4-Tetrafluorobenzene?
The CAS number of 1,2,3,4-Tetrafluorobenzene is 551-62-2.
What is the European Community (EC) number of 1,2,3,4-Tetrafluorobenzene?
The European Community (EC) number of 1,2,3,4-Tetrafluorobenzene is 248-779-8.
How many hydrogen bond acceptor counts does 1,2,3,4-Tetrafluorobenzene have?
1,2,3,4-Tetrafluorobenzene has 4 hydrogen bond acceptor counts.
