Catalog Number | ACM367237-2 |
CAS | 367-23-7 |
Structure | |
Appearance | Colorless transparent liquid, boiling point 90~91°C |
Content | 99.0% Min |
What is the molecular formula of 1,2,4-Trifluorobenzene?
The molecular formula of 1,2,4-Trifluorobenzene is C6H3F3.
What is the molecular weight of 1,2,4-Trifluorobenzene?
The molecular weight of 1,2,4-Trifluorobenzene is 132.08 g/mol.
What is the IUPAC name of 1,2,4-Trifluorobenzene?
The IUPAC name of 1,2,4-Trifluorobenzene is 1,2,4-trifluorobenzene.
What is the InChI of 1,2,4-Trifluorobenzene?
The InChI of 1,2,4-Trifluorobenzene is InChI=1S/C6H3F3/c7-4-1-2-5(8)6(9)3-4/h1-3H.
What is the InChIKey of 1,2,4-Trifluorobenzene?
The InChIKey of 1,2,4-Trifluorobenzene is PEBWOGPSYUIOBP-UHFFFAOYSA-N.
What is the canonical SMILES of 1,2,4-Trifluorobenzene?
The canonical SMILES of 1,2,4-Trifluorobenzene is C1=CC(=C(C=C1F)F)F.
What is the CAS number of 1,2,4-Trifluorobenzene?
The CAS number of 1,2,4-Trifluorobenzene is 367-23-7.
What is the European Community (EC) number of 1,2,4-Trifluorobenzene?
The European Community (EC) number of 1,2,4-Trifluorobenzene is 206-684-9.
What is the UNII of 1,2,4-Trifluorobenzene?
The UNII of 1,2,4-Trifluorobenzene is QWW4HNQ0L1.
Is 1,2,4-Trifluorobenzene a covalently-bonded unit?
Yes, 1,2,4-Trifluorobenzene is a covalently-bonded unit with a count of 1.
If you have any other questions or need other size, please get a quote.
※ Please kindly note that our products are for research use only.