Catalog Number | ACM102488493-3 |
CAS | 102488-49-3 |
Structure | |
Description | 97% |
Synonyms | [2-(Perfluorodec-1-yl)ethyl]trichlorosilane |
IUPAC Name | Trichloro(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-henicosafluorododecyl)silane |
Molecular Weight | 681.6 |
Molecular Formula | CF3(CF2)9CH2CH2SiCl3 |
Canonical SMILES | C(C[Si](Cl)(Cl)Cl)C(C(C(C(C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F |
InChI | InChI=1S/C12H4Cl3F21Si/c13-37(14,15)2-1-3(16,17)4(18,19)5(20,21)6(22,23)7(24,25)8(26,27)9(28,29)10(30,31)11(32,33)12(34,35)36/h1-2H2 |
InChI Key | ZFUVZJADECZZMS-UHFFFAOYSA-N |
Boiling Point | 90-92 °C |
Melting Point | 50-55 °C |
Flash Point | >110 °C |
Purity | 95%+ |
Unit Size | 5 G |
Vapor Pressure | 14 mmHg ( 18 °C) |
What is the molecular formula of 1H,1H,2H,2H-Perfluorododecyltrichlorosilane?
The molecular formula is C12H4Cl3F21Si.
What are the synonyms of 1H,1H,2H,2H-Perfluorododecyltrichlorosilane?
The synonyms are trichloro(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-henicosafluorododecyl)silane and Silane, trichloro(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-heneicosafluorododecyl)-.
What is the molecular weight of 1H,1H,2H,2H-Perfluorododecyltrichlorosilane?
The molecular weight is 681.6 g/mol.
What is the IUPAC name of 1H,1H,2H,2H-Perfluorododecyltrichlorosilane?
The IUPAC name is trichloro(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-henicosafluorododecyl)silane.
What is the InChI of 1H,1H,2H,2H-Perfluorododecyltrichlorosilane?
The InChI is InChI=1S/C12H4Cl3F21Si/c13-37(14,15)2-1-3(16,17)4(18,19)5(20,21)6(22,23)7(24,25)8(26,27)9(28,29)10(30,31)11(32,33)12(34,35)36/h1-2H2.
What is the InChIKey of 1H,1H,2H,2H-Perfluorododecyltrichlorosilane?
The InChIKey is ZFUVZJADECZZMS-UHFFFAOYSA-N.
What is the canonical SMILES of 1H,1H,2H,2H-Perfluorododecyltrichlorosilane?
The canonical SMILES is C(C[Si](Cl)(Cl)Cl)C(C(C(C(C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F.
What is the CAS number of 1H,1H,2H,2H-Perfluorododecyltrichlorosilane?
The CAS number is 102488-49-3.
What is the European Community (EC) number of 1H,1H,2H,2H-Perfluorododecyltrichlorosilane?
The European Community (EC) number is 662-991-1.
If you have any other questions or need other size, please get a quote.
※ Please kindly note that our products are for research use only.