2,3,4,5-Tetrafluorobenzoic acid

Catalog Number	ACM1201316-2
CAS	1201-31-6
Structure
Description	2,3,4,5-Tetrafluorobenzoic Acid is used in the synthesis of diterpenoid analogs as antitumor compounds. Also used in the synthesis of novel quinoline lactones.
Synonyms	2,3,4,5-tetrafluoro benzoic acid;F0293-0125;2-H-C6F4COOH;2,3,3′,4′,5,5′,6-HEPTACHLOROBIPHENYL;2,3,4,5-Tetrafluorobenzoic Acid
Molecular Formula	C7H2F4O2
Melting Point	85-88ºC
Flash Point	98.5ºC
Density	1.633 g/cm³
Appearance	White to pale yellow powder
Content	98.0% Min

Custom Q&A

What is the molecular formula of 2,3,4,5-Tetrafluorobenzoic acid?

The molecular formula is C7H2F4O2.

What is the molecular weight of 2,3,4,5-Tetrafluorobenzoic acid?

The molecular weight is 194.08 g/mol.

How is the IUPAC name of 2,3,4,5-Tetrafluorobenzoic acid computed?

It is computed as 2,3,4,5-tetrafluorobenzoic acid.

What is the InChI of 2,3,4,5-Tetrafluorobenzoic acid?

The InChI is InChI=1S/C7H2F4O2/c8-3-1-2(7(12)13)4(9)6(11)5(3)10/h1H,(H,12,13).

What is the InChIKey of 2,3,4,5-Tetrafluorobenzoic acid?

The InChIKey is SFKRXQKJTIYUAG-UHFFFAOYSA-N.

What is the Canonical SMILES of 2,3,4,5-Tetrafluorobenzoic acid?

The Canonical SMILES is C1=C(C(=C(C(=C1F)F)F)F)C(=O)O.

What is the CAS number of 2,3,4,5-Tetrafluorobenzoic acid?

The CAS number is 1201-31-6.

What is the XLogP3-AA value of 2,3,4,5-Tetrafluorobenzoic acid?

The XLogP3-AA value is 1.8.

How many hydrogen bond acceptor counts does 2,3,4,5-Tetrafluorobenzoic acid have?

It has 6 hydrogen bond acceptor counts.

Is the compound canonicalized?

Yes, the compound is canonicalized.

If you have any other questions or need other size, please get a quote.

※ Please kindly note that our products are for research use only.