What is the molecular formula of 2,3,5,6-Tetrafluoroaniline?
The molecular formula is C6H3F4N.
What is the molecular weight of 2,3,5,6-Tetrafluoroaniline?
The molecular weight is 165.09 g/mol.
What is the IUPAC name of 2,3,5,6-Tetrafluoroaniline?
The IUPAC name is 2,3,5-tetrafluoroaniline.
What is the InChI of 2,3,5,6-Tetrafluoroaniline?
The InChI is InChI=1S/C6H3F4N/c7-2-1-3(8)5(10)6(11)4(2)9/h1H,11H2.
What is the InChIKey of 2,3,5,6-Tetrafluoroaniline?
The InChIKey is SPSWJTZNOXMMMV-UHFFFAOYSA-N.
What is the canonical SMILES of 2,3,5,6-Tetrafluoroaniline?
The canonical SMILES is C1=C(C(=C(C(=C1F)F)N)F)F.
What is the CAS number of 2,3,5,6-Tetrafluoroaniline?
The CAS number is 700-17-4.
What is the European Community (EC) number of 2,3,5,6-Tetrafluoroaniline?
The EC number is 211-840-4.
What is the UNII of 2,3,5,6-Tetrafluoroaniline?
The UNII is L6G8W27VFU.
Is 2,3,5,6-Tetrafluoroaniline a canonicalized compound?
Yes, it is a canonicalized compound.
