2,4,5-Trifluoroaniline

Catalog Number	ACM367340-2
CAS	367-34-0
Structure
Appearance	Light yellow liquid, boiling point 89~90°C/43Torr
Content	99.0% Min

Custom Q&A

What is the molecular formula of 2,4,5-Trifluoroaniline?

The molecular formula is C6H4F3N.

What is the molecular weight of 2,4,5-Trifluoroaniline?

The molecular weight is 147.10 g/mol.

What is the IUPAC name of 2,4,5-Trifluoroaniline?

The IUPAC name is 2,4,5-trifluoroaniline.

What is the InChI of 2,4,5-Trifluoroaniline?

The InChI is InChI=1S/C6H4F3N/c7-3-1-5(9)6(10)2-4(3)8/h1-2H,10H2.

What is the InChIKey of 2,4,5-Trifluoroaniline?

The InChIKey is QMYVWJVVVMIBMM-UHFFFAOYSA-N.

What is the canonical SMILES of 2,4,5-Trifluoroaniline?

The canonical SMILES is C1=C(C(=CC(=C1F)F)F)N.

What is the CAS number of 2,4,5-Trifluoroaniline?

The CAS number is 367-34-0.

What is the European Community (EC) number of 2,4,5-Trifluoroaniline?

The EC number is 206-692-2.

What is the UNII of 2,4,5-Trifluoroaniline?

The UNII is 84X2Y688WR.

How many hydrogen bond donor counts does 2,4,5-Trifluoroaniline have?

2,4,5-Trifluoroaniline has 1 hydrogen bond donor count.

If you have any other questions or need other size, please get a quote.

※ Please kindly note that our products are for research use only.