Catalog Number | ACM367340-2 |
CAS | 367-34-0 |
Structure | |
Appearance | Light yellow liquid, boiling point 89~90°C/43Torr |
Content | 99.0% Min |
What is the molecular formula of 2,4,5-Trifluoroaniline?
The molecular formula is C6H4F3N.
What is the molecular weight of 2,4,5-Trifluoroaniline?
The molecular weight is 147.10 g/mol.
What is the IUPAC name of 2,4,5-Trifluoroaniline?
The IUPAC name is 2,4,5-trifluoroaniline.
What is the InChI of 2,4,5-Trifluoroaniline?
The InChI is InChI=1S/C6H4F3N/c7-3-1-5(9)6(10)2-4(3)8/h1-2H,10H2.
What is the InChIKey of 2,4,5-Trifluoroaniline?
The InChIKey is QMYVWJVVVMIBMM-UHFFFAOYSA-N.
What is the canonical SMILES of 2,4,5-Trifluoroaniline?
The canonical SMILES is C1=C(C(=CC(=C1F)F)F)N.
What is the CAS number of 2,4,5-Trifluoroaniline?
The CAS number is 367-34-0.
What is the European Community (EC) number of 2,4,5-Trifluoroaniline?
The EC number is 206-692-2.
What is the UNII of 2,4,5-Trifluoroaniline?
The UNII is 84X2Y688WR.
How many hydrogen bond donor counts does 2,4,5-Trifluoroaniline have?
2,4,5-Trifluoroaniline has 1 hydrogen bond donor count.
If you have any other questions or need other size, please get a quote.
※ Please kindly note that our products are for research use only.