What is the molecular formula of 2,4,5-Trifluorobenzoic acid?
The molecular formula of 2,4,5-Trifluorobenzoic acid is C7H3F3O2.
What is the molecular weight of 2,4,5-Trifluorobenzoic acid?
The molecular weight of 2,4,5-Trifluorobenzoic acid is 176.09 g/mol.
What is the IUPAC name of 2,4,5-Trifluorobenzoic acid?
The IUPAC name of 2,4,5-Trifluorobenzoic acid is 2,4,5-trifluorobenzoic acid.
What is the InChI of 2,4,5-Trifluorobenzoic acid?
The InChI of 2,4,5-Trifluorobenzoic acid is InChI=1S/C7H3F3O2/c8-4-2-6(10)5(9)1-3(4)7(11)12/h1-2H,(H,11,12).
What is the InChIKey of 2,4,5-Trifluorobenzoic acid?
The InChIKey of 2,4,5-Trifluorobenzoic acid is AKAMNXFLKYKFOJ-UHFFFAOYSA-N.
What is the canonical SMILES of 2,4,5-Trifluorobenzoic acid?
The canonical SMILES of 2,4,5-Trifluorobenzoic acid is C1=C(C(=CC(=C1F)F)F)C(=O)O.
What is the CAS number of 2,4,5-Trifluorobenzoic acid?
The CAS number of 2,4,5-Trifluorobenzoic acid is 446-17-3.
How many hydrogen bond donor counts are there in 2,4,5-Trifluorobenzoic acid?
There is 1 hydrogen bond donor count in 2,4,5-Trifluorobenzoic acid.
How many hydrogen bond acceptor counts are there in 2,4,5-Trifluorobenzoic acid?
There are 5 hydrogen bond acceptor counts in 2,4,5-Trifluorobenzoic acid.
