| Catalog Number |
ACM28177482 |
| CAS |
28177-48-2 |
| Structure |
 |
| Synonyms |
Phenol, 2,6-difluoro- |
| IUPAC Name |
2,6-difluorophenol |
| Molecular Weight |
130.09 |
| Molecular Formula |
C6H4F2O |
| Canonical SMILES |
C1=CC(=C(C(=C1)F)O)F |
| InChI |
InChI=1S/C6H4F2O/c7-4-2-1-3-5(8)6(4)9/h1-3,9H |
| InChI Key |
CKKOVFGIBXCEIJ-UHFFFAOYSA-N |
| Boiling Point |
59-61 °C |
| Melting Point |
38-41 °C |
| Purity |
98%+ |
| Density |
1.27 g/ml |
| Appearance |
Off-white crystal |
If you have any other questions or need other size, please get a quote.
※ Please kindly note that our products are for research use only.
