4-Chloro-2-fluoroaniline

Catalog Number	ACM57946562-2
CAS	57946-56-2
Structure
Appearance	Colorless to light red liquid or solid, melting point 31~32°C, boiling point 158~159°C
Content	99.0% Min

Custom Q&A

What is the molecular formula of 4-Chloro-2-fluoroaniline?

The molecular formula of 4-Chloro-2-fluoroaniline is C6H5ClFN.

What is the molecular weight of 4-Chloro-2-fluoroaniline?

The molecular weight of 4-Chloro-2-fluoroaniline is 145.56 g/mol.

What is the IUPAC name of 4-Chloro-2-fluoroaniline?

The IUPAC name of 4-Chloro-2-fluoroaniline is 4-chloro-2-fluoroaniline.

What is the InChI of 4-Chloro-2-fluoroaniline?

The InChI of 4-Chloro-2-fluoroaniline is InChI=1S/C6H5ClFN/c7-4-1-2-6(9)5(8)3-4/h1-3H,9H2.

What is the InChIKey of 4-Chloro-2-fluoroaniline?

The InChIKey of 4-Chloro-2-fluoroaniline is CSFDTBRRIBJILD-UHFFFAOYSA-N.

What is the canonical SMILES of 4-Chloro-2-fluoroaniline?

The canonical SMILES of 4-Chloro-2-fluoroaniline is C1=CC(=C(C=C1Cl)F)N.

What is the CAS number of 4-Chloro-2-fluoroaniline?

The CAS number of 4-Chloro-2-fluoroaniline is 57946-56-2.

What is the European Community (EC) number of 4-Chloro-2-fluoroaniline?

The European Community (EC) number of 4-Chloro-2-fluoroaniline is 261-034-1.

What is the DSSTox Substance ID of 4-Chloro-2-fluoroaniline?

The DSSTox Substance ID of 4-Chloro-2-fluoroaniline is DTXSID00206666.

Is 4-Chloro-2-fluoroaniline a canonicalized compound?

Yes, 4-Chloro-2-fluoroaniline is a canonicalized compound.

If you have any other questions or need other size, please get a quote.

※ Please kindly note that our products are for research use only.