What is the molecular formula of 2,3,4,5-Tetrafluorobenzyl alcohol?
The molecular formula of 2,3,4,5-Tetrafluorobenzyl alcohol is C7H4F4O.
What is the molecular weight of 2,3,4,5-Tetrafluorobenzyl alcohol?
The molecular weight of 2,3,4,5-Tetrafluorobenzyl alcohol is 180.10 g/mol.
What is the IUPAC name of 2,3,4,5-Tetrafluorobenzyl alcohol?
The IUPAC name of 2,3,4,5-Tetrafluorobenzyl alcohol is (2,3,4,5-tetrafluorophenyl)methanol.
What is the InChI of 2,3,4,5-Tetrafluorobenzyl alcohol?
The InChI of 2,3,4,5-Tetrafluorobenzyl alcohol is InChI=1S/C7H4F4O/c8-4-1-3(2-12)5(9)7(11)6(4)10/h1,12H,2H2.
What is the InChIKey of 2,3,4,5-Tetrafluorobenzyl alcohol?
The InChIKey of 2,3,4,5-Tetrafluorobenzyl alcohol is HLUZGUMMQYQHKJ-UHFFFAOYSA-N.
What is the canonical SMILES of 2,3,4,5-Tetrafluorobenzyl alcohol?
The canonical SMILES of 2,3,4,5-Tetrafluorobenzyl alcohol is C1=C(C(=C(C(=C1F)F)F)F)CO.
What is the CAS number of 2,3,4,5-Tetrafluorobenzyl alcohol?
The CAS number of 2,3,4,5-Tetrafluorobenzyl alcohol is 53072-18-7.
What is the XLogP3-AA value of 2,3,4,5-Tetrafluorobenzyl alcohol?
The XLogP3-AA value of 2,3,4,5-Tetrafluorobenzyl alcohol is 1.4.
How many hydrogen bond donor counts are there in 2,3,4,5-Tetrafluorobenzyl alcohol?
There is 1 hydrogen bond donor count in 2,3,4,5-Tetrafluorobenzyl alcohol.
How many hydrogen bond acceptor counts are there in 2,3,4,5-Tetrafluorobenzyl alcohol?
There are 5 hydrogen bond acceptor counts in 2,3,4,5-Tetrafluorobenzyl alcohol.
